jhkem123
jhkem123 jhkem123
  • 15-11-2022
  • Mathematics
contestada

From a sample with n=40, the mean duration of a geyser's eruption is 3.35 minutes and the standard deviation is 0.79 minutes. Using Chebychev's Theorem, determine at least how many of the eruptions lasted between 1.77 and 4.93 minutes.

Respuesta :

Otras preguntas

Pigment like chlorophyll and carotene are molecules that plants use to
How does Washington Irving’s use of the third-person omniscient narrator in "Rip Van Winkle" affect the meaning and development of the story? Incorporate inform
how many moles of Cu are needed to react with 3.00mples of AgNO3equation: Cu + 2AgNO3--> Cu(NO3)2 + 2Ag​
Find the average value of the function on the given interval. f(x)=x^2e^2x; [0,2]
Tix on sale at 35% reg is 210$ how much is discount
When the levels of greenhouse gases in Earth's atmosphere increase, which statement is true?
Balance the reaction of c6h12o6(s)+o2(g)=co2(g)+h2o(l)
How many grams of silver chloride are produced from 5.0 g of silver nitrate reacting with an excess of barium chloride?
Why did the United States enter war in 1917
What is the distance between points F(2,9) and G(4,14)? Round to the nearest whole number. Please show steps! Thank you!❤