Seudónimo Seudónimo

13-10-2017
English

contestada

A _____ outline expresses ideas as words or phrases. A.paragraph B.sentence C.cyclical D.topic

Respuesta :

louis05alfaro louis05alfaro

13-10-2017

The answer is "B.sentence"

Answer Link

kristianli kristianli

13-10-2017

the answer would be b a sentence

Answer Link

Otras preguntas

Infinity Corporation purchased equipment with a 10-year useful life and zero residual value for $10,000. At the end of the fifth year, the equipment is sold for

Helllppppppppp Helllppppppppp Helllppppppppp

What is the value of x? A.10.5 B.18.7 C.7.7 D.7.0

Collecting _____ data is usually easier than collecting _____ data because the assessment can usually be done more quickly by a simple inspection or count. a.

In this program, you will create an object and display it. Create a class nerf Gun that includes data members model (string), range(int), capacity (int), and nu

What does Get together mean?

If a certain number is decreased by 9,the result is 24. What is the number? please someone answer this asap i need it thanks!

there are about 118 elements each of which has its own chemical:

why is √ 13 less than 6.4

Give the structural formula of the compound with the condensed structural formula of CH3C(CH3)2C(CH2CH3)2CH2CH2CH2CH2CH3. Draw the molecule on the canvas by cho